C18H21BBrFN2O3 — CID 171114003
3-(4-bromophenyl)-5-[3-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-1,2,4-oxadiazole (PubChem CID 171114003) has the molecular formula C18H21BBrFN2O3 and a molecular weight of 423.09 g/mol. Its IUPAC name is 3-(4-bromophenyl)-5-[3-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-1,2,4-oxadiazole.
| Compound Name | 3-(4-bromophenyl)-5-[3-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 171114003 |
| Molecular Formula | C18H21BBrFN2O3 |
| Molecular Weight | 423.09 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 3-(4-bromophenyl)-5-[3-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-1,2,4-oxadiazole |
| SMILES | CC(Cc1nc(-c2ccc(Br)cc2)no1)=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H21BBrFN2O3/c1-11(15(21)19-25-17(2,3)18(4,5)26-19)10-14-22-16(23-24-14)12-6-8-13(20)9-7-12/h6-9H,10H2,1-5H3 |
| InChIKey | XLTWGEWVCZLNDX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.09 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|