C16H28BFN2O2 — CID 171114008
1-[2-cyclopropyl-3-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]piperazine (PubChem CID 171114008) has the molecular formula C16H28BFN2O2 and a molecular weight of 310.22 g/mol. Its IUPAC name is 1-[2-cyclopropyl-3-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]piperazine.
| Compound Name | 1-[2-cyclopropyl-3-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]piperazine |
|---|---|
| PubChem CID | 171114008 |
| Molecular Formula | C16H28BFN2O2 |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 1-[2-cyclopropyl-3-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]piperazine |
| SMILES | CC1(C)OB(C(F)=C(CN2CCNCC2)C2CC2)OC1(C)C |
| InChI | InChI=1S/C16H28BFN2O2/c1-15(2)16(3,4)22-17(21-15)14(18)13(12-5-6-12)11-20-9-7-19-8-10-20/h12,19H,5-11H2,1-4H3 |
| InChIKey | NRVGGKYNOMQSQY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|