C21H29BFNO4 — CID 171114046
methyl 4-[2-fluoro-1-piperidin-4-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzoate (PubChem CID 171114046) has the molecular formula C21H29BFNO4 and a molecular weight of 389.28 g/mol. Its IUPAC name is methyl 4-[2-fluoro-1-piperidin-4-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzoate.
| Compound Name | methyl 4-[2-fluoro-1-piperidin-4-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzoate |
|---|---|
| PubChem CID | 171114046 |
| Molecular Formula | C21H29BFNO4 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | methyl 4-[2-fluoro-1-piperidin-4-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=C(F)B2OC(C)(C)C(C)(C)O2)C2CCNCC2)cc1 |
| InChI | InChI=1S/C21H29BFNO4/c1-20(2)21(3,4)28-22(27-20)18(23)17(15-10-12-24-13-11-15)14-6-8-16(9-7-14)19(25)26-5/h6-9,15,24H,10-13H2,1-5H3 |
| InChIKey | KQPXOKHJBSYPOD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|