C22H27BFNO3 — CID 171114129
1-[3-[4-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]phenyl]prop-2-ynyl]pyrrolidin-2-one (PubChem CID 171114129) has the molecular formula C22H27BFNO3 and a molecular weight of 383.27 g/mol. Its IUPAC name is 1-[3-[4-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]phenyl]prop-2-ynyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[4-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]phenyl]prop-2-ynyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 171114129 |
| Molecular Formula | C22H27BFNO3 |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 1-[3-[4-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]phenyl]prop-2-ynyl]pyrrolidin-2-one |
| SMILES | CC(=C(F)B1OC(C)(C)C(C)(C)O1)c1ccc(C#CCN2CCCC2=O)cc1 |
| InChI | InChI=1S/C22H27BFNO3/c1-16(20(24)23-27-21(2,3)22(4,5)28-23)18-12-10-17(11-13-18)8-6-14-25-15-7-9-19(25)26/h10-13H,7,9,14-15H2,1-5H3 |
| InChIKey | NLYGOJBRWWZZTK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|