C17H20BBrFNO2 — CID 171114443
6-bromo-3-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-1H-indole (PubChem CID 171114443) has the molecular formula C17H20BBrFNO2 and a molecular weight of 380.07 g/mol. Its IUPAC name is 6-bromo-3-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-1H-indole.
| Compound Name | 6-bromo-3-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-1H-indole |
|---|---|
| PubChem CID | 171114443 |
| Molecular Formula | C17H20BBrFNO2 |
| Molecular Weight | 380.07 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 6-bromo-3-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-1H-indole |
| SMILES | CC(=C(F)B1OC(C)(C)C(C)(C)O1)c1c[nH]c2cc(Br)ccc12 |
| InChI | InChI=1S/C17H20BBrFNO2/c1-10(13-9-21-14-8-11(19)6-7-12(13)14)15(20)18-22-16(2,3)17(4,5)23-18/h6-9,21H,1-5H3 |
| InChIKey | MSHZWJRCLKMWLE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.07 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|