C15H20BFO4S — CID 171114456
5-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 171114456) has the molecular formula C15H20BFO4S and a molecular weight of 326.20 g/mol. Its IUPAC name is 5-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 171114456 |
| Molecular Formula | C15H20BFO4S |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 5-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | CC(=C(F)B1OC(C)(C)C(C)(C)O1)c1scc2c1OCCO2 |
| InChI | InChI=1S/C15H20BFO4S/c1-9(12-11-10(8-22-12)18-6-7-19-11)13(17)16-20-14(2,3)15(4,5)21-16/h8H,6-7H2,1-5H3 |
| InChIKey | XUASQORARQTUDC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|