C19H19NO8 — CID 171114879
3,4,5-trihydroxy-6-[2-(phenylcarbamoyl)phenoxy]oxane-2-carboxylic acid (PubChem CID 171114879) has the molecular formula C19H19NO8 and a molecular weight of 389.36 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-[2-(phenylcarbamoyl)phenoxy]oxane-2-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-6-[2-(phenylcarbamoyl)phenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 171114879 |
| Molecular Formula | C19H19NO8 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 3,4,5-trihydroxy-6-[2-(phenylcarbamoyl)phenoxy]oxane-2-carboxylic acid |
| SMILES | O=C(Nc1ccccc1)c1ccccc1OC1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C19H19NO8/c21-13-14(22)16(18(25)26)28-19(15(13)23)27-12-9-5-4-8-11(12)17(24)20-10-6-2-1-3-7-10/h1-9,13-16,19,21-23H,(H,20,24)(H,25,26) |
| InChIKey | PAYRTHRSGVKKRK-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |