C24H26O7 — CID 171114919
3,4,5-trihydroxy-6-[4-[(3E)-4-phenylhexa-1,3-dien-3-yl]phenoxy]oxane-2-carboxylic acid (PubChem CID 171114919) has the molecular formula C24H26O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-[4-[(3E)-4-phenylhexa-1,3-dien-3-yl]phenoxy]oxane-2-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-6-[4-[(3E)-4-phenylhexa-1,3-dien-3-yl]phenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 171114919 |
| Molecular Formula | C24H26O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 3,4,5-trihydroxy-6-[4-[(3E)-4-phenylhexa-1,3-dien-3-yl]phenoxy]oxane-2-carboxylic acid |
| SMILES | C=C/C(=C(/CC)c1ccccc1)c1ccc(OC2OC(C(=O)O)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C24H26O7/c1-3-17(14-8-6-5-7-9-14)18(4-2)15-10-12-16(13-11-15)30-24-21(27)19(25)20(26)22(31-24)23(28)29/h4-13,19-22,24-27H,2-3H2,1H3,(H,28,29)/b18-17+ |
| InChIKey | YDQKJWPPUSGZOX-ISLYRVAYSA-N |
| XLogP | 2.46 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|