C22H27N2O7+ — CID 171114979
6-[(8-amino-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 171114979) has the molecular formula C22H27N2O7+ and a molecular weight of 431.47 g/mol. Its IUPAC name is 6-[(8-amino-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[(8-amino-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 171114979 |
| Molecular Formula | C22H27N2O7+ |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 6-[(8-amino-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | C[N+]1(OC2OC(C(=O)O)C(O)C(O)C2O)Cc2c(N)cccc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C22H26N2O7/c1-24(31-22-19(27)17(25)18(26)20(30-22)21(28)29)10-14(12-6-3-2-4-7-12)13-8-5-9-16(23)15(13)11-24/h2-9,14,17-20,22,25-27H,10-11,23H2,1H3/p+1 |
| InChIKey | XTVONLGWQOZWJK-UHFFFAOYSA-O |
| XLogP | 0.18 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|