C15H13Br2NO7 — CID 171115063
6-(5,7-dibromoquinolin-8-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 171115063) has the molecular formula C15H13Br2NO7 and a molecular weight of 479.08 g/mol. Its IUPAC name is 6-(5,7-dibromoquinolin-8-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-(5,7-dibromoquinolin-8-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 171115063 |
| Molecular Formula | C15H13Br2NO7 |
| Molecular Weight | 479.08 g/mol |
| Exact Mass | 476.91 |
| IUPAC Name | 6-(5,7-dibromoquinolin-8-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)C1OC(Oc2c(Br)cc(Br)c3cccnc23)C(O)C(O)C1O |
| InChI | InChI=1S/C15H13Br2NO7/c16-6-4-7(17)12(8-5(6)2-1-3-18-8)24-15-11(21)9(19)10(20)13(25-15)14(22)23/h1-4,9-11,13,15,19-21H,(H,22,23) |
| InChIKey | UGGDOZVDHYFYJT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.08 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |