C16H26O7 — CID 171115203
6-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 171115203) has the molecular formula C16H26O7 and a molecular weight of 330.38 g/mol. Its IUPAC name is 6-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 171115203 |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 6-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC(C)=CCC/C(C)=C\COC1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C16H26O7/c1-9(2)5-4-6-10(3)7-8-22-16-13(19)11(17)12(18)14(23-16)15(20)21/h5,7,11-14,16-19H,4,6,8H2,1-3H3,(H,20,21)/b10-7- |
| InChIKey | XJJHWRIXQMBBGX-YFHOEESVSA-N |
| XLogP | 0.59 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|