About (1H-indazol-7-ylamino) acetate
(1H-indazol-7-ylamino) acetate (PubChem CID 171115209) has the molecular formula C9H9N3O2
and a molecular weight of 191.19 g/mol. Its IUPAC name is (1H-indazol-7-ylamino) acetate.
Molecular Properties
| Compound Name | (1H-indazol-7-ylamino) acetate |
| PubChem CID | 171115209 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | (1H-indazol-7-ylamino) acetate |
| SMILES | CC(=O)ONc1cccc2cn[nH]c12 |
| InChI | InChI=1S/C9H9N3O2/c1-6(13)14-12-8-4-2-3-7-5-10-11-9(7)8/h2-5,12H,1H3,(H,10,11) |
| InChIKey | LIUDTQAYKCWYCI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1H-indazol-7-ylamino) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1H-indazol-7-ylamino) acetate?
The IUPAC name of (1H-indazol-7-ylamino) acetate (CID 171115209) is (1H-indazol-7-ylamino) acetate.
What is the SMILES notation for (1H-indazol-7-ylamino) acetate?
The canonical SMILES for (1H-indazol-7-ylamino) acetate is CC(=O)ONc1cccc2cn[nH]c12.
What is the InChIKey of (1H-indazol-7-ylamino) acetate?
The InChIKey is LIUDTQAYKCWYCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c1-6(13)14-12-8-4-2-3-7-5-10-11-9(7)8/h2-5,12H,1H3,(H,10,11).
What are the key properties of (1H-indazol-7-ylamino) acetate?
(1H-indazol-7-ylamino) acetate has a molecular weight of 191.19 g/mol, XLogP of 1.45, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1H-indazol-7-ylamino) acetate is sourced from PubChem (CID 171115209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).