C18H26ClN7O7 — CID 171115213
6-[[6-(azepan-1-yl)-5-chloro-3-(diaminomethylidenecarbamoyl)pyrazin-2-yl]amino]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 171115213) has the molecular formula C18H26ClN7O7 and a molecular weight of 487.90 g/mol. Its IUPAC name is 6-[[6-(azepan-1-yl)-5-chloro-3-(diaminomethylidenecarbamoyl)pyrazin-2-yl]amino]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[[6-(azepan-1-yl)-5-chloro-3-(diaminomethylidenecarbamoyl)pyrazin-2-yl]amino]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 171115213 |
| Molecular Formula | C18H26ClN7O7 |
| Molecular Weight | 487.90 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 6-[[6-(azepan-1-yl)-5-chloro-3-(diaminomethylidenecarbamoyl)pyrazin-2-yl]amino]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | NC(N)=NC(=O)c1nc(Cl)c(N2CCCCCC2)nc1NC1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C18H26ClN7O7/c19-12-14(26-5-3-1-2-4-6-26)23-13(7(22-12)15(30)25-18(20)21)24-16-10(29)8(27)9(28)11(33-16)17(31)32/h8-11,16,27-29H,1-6H2,(H,23,24)(H,31,32)(H4,20,21,25,30) |
| InChIKey | ALQHZVIRFBYSRM-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 229.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.90 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|