C9H12N4 — CID 171115231
1,2,3,4,5,6-hexahydroquinazolin-2-ylcyanamide (PubChem CID 171115231) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexahydroquinazolin-2-ylcyanamide.
| Compound Name | 1,2,3,4,5,6-hexahydroquinazolin-2-ylcyanamide |
|---|---|
| PubChem CID | 171115231 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1,2,3,4,5,6-hexahydroquinazolin-2-ylcyanamide |
| SMILES | N#CNC1NCC2=C(C=CCC2)N1 |
| InChI | InChI=1S/C9H12N4/c10-6-12-9-11-5-7-3-1-2-4-8(7)13-9/h2,4,9,11-13H,1,3,5H2 |
| InChIKey | OSZOFKNNGQKAEW-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 59.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|