About 5-amino-3-(1H-indol-2-yl)-1,2-oxazole-4-carbonitrile
5-amino-3-(1H-indol-2-yl)-1,2-oxazole-4-carbonitrile (PubChem CID 171115248) has the molecular formula C12H8N4O
and a molecular weight of 224.22 g/mol. Its IUPAC name is 5-amino-3-(1H-indol-2-yl)-1,2-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-3-(1H-indol-2-yl)-1,2-oxazole-4-carbonitrile |
| PubChem CID | 171115248 |
| Molecular Formula | C12H8N4O |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 5-amino-3-(1H-indol-2-yl)-1,2-oxazole-4-carbonitrile |
| SMILES | N#Cc1c(-c2cc3ccccc3[nH]2)noc1N |
| InChI | InChI=1S/C12H8N4O/c13-6-8-11(16-17-12(8)14)10-5-7-3-1-2-4-9(7)15-10/h1-5,15H,14H2 |
| InChIKey | LQAVFCCCZUTYFK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-3-(1H-indol-2-yl)-1,2-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-(1H-indol-2-yl)-1,2-oxazole-4-carbonitrile?
The IUPAC name of 5-amino-3-(1H-indol-2-yl)-1,2-oxazole-4-carbonitrile (CID 171115248) is 5-amino-3-(1H-indol-2-yl)-1,2-oxazole-4-carbonitrile.
What is the SMILES notation for 5-amino-3-(1H-indol-2-yl)-1,2-oxazole-4-carbonitrile?
The canonical SMILES for 5-amino-3-(1H-indol-2-yl)-1,2-oxazole-4-carbonitrile is N#Cc1c(-c2cc3ccccc3[nH]2)noc1N.
What is the InChIKey of 5-amino-3-(1H-indol-2-yl)-1,2-oxazole-4-carbonitrile?
The InChIKey is LQAVFCCCZUTYFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4O/c13-6-8-11(16-17-12(8)14)10-5-7-3-1-2-4-9(7)15-10/h1-5,15H,14H2.
What are the key properties of 5-amino-3-(1H-indol-2-yl)-1,2-oxazole-4-carbonitrile?
5-amino-3-(1H-indol-2-yl)-1,2-oxazole-4-carbonitrile has a molecular weight of 224.22 g/mol, XLogP of 2.28, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-(1H-indol-2-yl)-1,2-oxazole-4-carbonitrile is sourced from PubChem (CID 171115248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).