C14H17BrCl2N2O4S — CID 171115289
8-(4-bromo-3,4-dichloro-2-nitro-1-prop-2-enylsulfanylbuta-1,3-dienyl)-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 171115289) has the molecular formula C14H17BrCl2N2O4S and a molecular weight of 460.18 g/mol. Its IUPAC name is 8-(4-bromo-3,4-dichloro-2-nitro-1-prop-2-enylsulfanylbuta-1,3-dienyl)-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-(4-bromo-3,4-dichloro-2-nitro-1-prop-2-enylsulfanylbuta-1,3-dienyl)-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 171115289 |
| Molecular Formula | C14H17BrCl2N2O4S |
| Molecular Weight | 460.18 g/mol |
| Exact Mass | 457.95 |
| IUPAC Name | 8-(4-bromo-3,4-dichloro-2-nitro-1-prop-2-enylsulfanylbuta-1,3-dienyl)-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | C=CCSC(=C(C(Cl)=C(Cl)Br)[N+](=O)[O-])N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H17BrCl2N2O4S/c1-2-9-24-13(11(19(20)21)10(16)12(15)17)18-5-3-14(4-6-18)22-7-8-23-14/h2H,1,3-9H2 |
| InChIKey | WBCQOKYYUQQCAY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.18 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|