C16H20F3NO2 — CID 171115591
4-[2-(cyclopropylmethoxy)-4-(trifluoromethoxy)phenyl]piperidine (PubChem CID 171115591) has the molecular formula C16H20F3NO2 and a molecular weight of 315.33 g/mol. Its IUPAC name is 4-[2-(cyclopropylmethoxy)-4-(trifluoromethoxy)phenyl]piperidine.
| Compound Name | 4-[2-(cyclopropylmethoxy)-4-(trifluoromethoxy)phenyl]piperidine |
|---|---|
| PubChem CID | 171115591 |
| Molecular Formula | C16H20F3NO2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 4-[2-(cyclopropylmethoxy)-4-(trifluoromethoxy)phenyl]piperidine |
| SMILES | FC(F)(F)Oc1ccc(C2CCNCC2)c(OCC2CC2)c1 |
| InChI | InChI=1S/C16H20F3NO2/c17-16(18,19)22-13-3-4-14(12-5-7-20-8-6-12)15(9-13)21-10-11-1-2-11/h3-4,9,11-12,20H,1-2,5-8,10H2 |
| InChIKey | NEWDEWDVKGMXHL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |