C6H8O6 — CID 171116100
(3R,4S,5R,7S)-4,7-dihydroxy-1,6-dioxaspiro[2.4]heptane-5-carboxylic acid (PubChem CID 171116100) has the molecular formula C6H8O6 and a molecular weight of 176.12 g/mol. Its IUPAC name is (3R,4S,5R,7S)-4,7-dihydroxy-1,6-dioxaspiro[2.4]heptane-5-carboxylic acid.
| Compound Name | (3R,4S,5R,7S)-4,7-dihydroxy-1,6-dioxaspiro[2.4]heptane-5-carboxylic acid |
|---|---|
| PubChem CID | 171116100 |
| Molecular Formula | C6H8O6 |
| Molecular Weight | 176.12 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | (3R,4S,5R,7S)-4,7-dihydroxy-1,6-dioxaspiro[2.4]heptane-5-carboxylic acid |
| SMILES | O=C(O)[C@@H]1O[C@H](O)[C@@]2(CO2)[C@H]1O |
| InChI | InChI=1S/C6H8O6/c7-3-2(4(8)9)12-5(10)6(3)1-11-6/h2-3,5,7,10H,1H2,(H,8,9)/t2-,3+,5+,6-/m1/s1 |
| InChIKey | ZSDWWELRJJXFSD-NPLBHXCJSA-N |
| XLogP | -2.08 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.12 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|