C16H22O3 — CID 171116388
(Z)-6-[(1S,5S)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]hex-4-enoic acid (PubChem CID 171116388) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (Z)-6-[(1S,5S)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]hex-4-enoic acid.
| Compound Name | (Z)-6-[(1S,5S)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 171116388 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (Z)-6-[(1S,5S)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]hex-4-enoic acid |
| SMILES | CC/C=C\C[C@@H]1C(=O)C=C[C@@H]1C/C=C\CCC(=O)O |
| InChI | InChI=1S/C16H22O3/c1-2-3-5-9-14-13(11-12-15(14)17)8-6-4-7-10-16(18)19/h3-6,11-14H,2,7-10H2,1H3,(H,18,19)/b5-3-,6-4-/t13-,14-/m0/s1 |
| InChIKey | CHFGZORVUOKWSG-NUGRLYJBSA-N |
| XLogP | 3.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|