C26H45N3O3 — CID 171116846
(2S)-2-[[(Z)-icos-11-enoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 171116846) has the molecular formula C26H45N3O3 and a molecular weight of 447.66 g/mol. Its IUPAC name is (2S)-2-[[(Z)-icos-11-enoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-[[(Z)-icos-11-enoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 171116846 |
| Molecular Formula | C26H45N3O3 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.35 |
| IUPAC Name | (2S)-2-[[(Z)-icos-11-enoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C26H45N3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(30)29-24(26(31)32)20-23-21-27-22-28-23/h9-10,21-22,24H,2-8,11-20H2,1H3,(H,27,28)(H,29,30)(H,31,32)/b10-9-/t24-/m0/s1 |
| InChIKey | ZXLTVZITDMYCGC-DHSLYTQISA-N |
| XLogP | 6.34 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|