C30H52O4 — CID 171117354
3-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxydecanoic acid (PubChem CID 171117354) has the molecular formula C30H52O4 and a molecular weight of 476.74 g/mol. Its IUPAC name is 3-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxydecanoic acid.
| Compound Name | 3-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxydecanoic acid |
|---|---|
| PubChem CID | 171117354 |
| Molecular Formula | C30H52O4 |
| Molecular Weight | 476.74 g/mol |
| Exact Mass | 476.39 |
| IUPAC Name | 3-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxydecanoic acid |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCCC(=O)OC(CCCCCCC)CC(=O)O |
| InChI | InChI=1S/C30H52O4/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-22-24-26-30(33)34-28(27-29(31)32)25-23-21-8-6-4-2/h10-11,13-14,16-17,28H,3-9,12,15,18-27H2,1-2H3,(H,31,32)/b11-10-,14-13-,17-16- |
| InChIKey | YVHNDHJBCKCVJO-NWFXIAEYSA-N |
| XLogP | 9.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.74 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|