3-dodecanoyloxyhexanoic acid

C18H34O4 — CID 171117373

IUPAC3-dodecanoyloxyhexanoic acid
SMILESCCCCCCCCCCCC(=O)OC(CCC)CC(=O)O
InChIInChI=1S/C18H34O4/c1-3-5-6-7-8-9-10-11-12-14-18(21)22-16(13-4-2)15-17(19)20/h16H,3-15H2,1-2H3,(H,19,20)
InChIKeyZZHGZJKGNRKJMH-UHFFFAOYSA-N
MW314.47 g/mol
LogP5.09
Rot. Bonds15

About 3-dodecanoyloxyhexanoic acid

3-dodecanoyloxyhexanoic acid (PubChem CID 171117373) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is 3-dodecanoyloxyhexanoic acid.

Molecular Properties

Compound Name3-dodecanoyloxyhexanoic acid
PubChem CID171117373
Molecular FormulaC18H34O4
Molecular Weight314.47 g/mol
Exact Mass314.25
IUPAC Name3-dodecanoyloxyhexanoic acid
SMILESCCCCCCCCCCCC(=O)OC(CCC)CC(=O)O
InChIInChI=1S/C18H34O4/c1-3-5-6-7-8-9-10-11-12-14-18(21)22-16(13-4-2)15-17(19)20/h16H,3-15H2,1-2H3,(H,19,20)
InChIKeyZZHGZJKGNRKJMH-UHFFFAOYSA-N
XLogP5.09
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds15
Heavy Atoms22
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500314.47
LogP ≤ 55.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-dodecanoyloxyhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-dodecanoyloxyhexanoic acid?
The IUPAC name of 3-dodecanoyloxyhexanoic acid (CID 171117373) is 3-dodecanoyloxyhexanoic acid.
What is the SMILES notation for 3-dodecanoyloxyhexanoic acid?
The canonical SMILES for 3-dodecanoyloxyhexanoic acid is CCCCCCCCCCCC(=O)OC(CCC)CC(=O)O.
What is the InChIKey of 3-dodecanoyloxyhexanoic acid?
The InChIKey is ZZHGZJKGNRKJMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O4/c1-3-5-6-7-8-9-10-11-12-14-18(21)22-16(13-4-2)15-17(19)20/h16H,3-15H2,1-2H3,(H,19,20).
What are the key properties of 3-dodecanoyloxyhexanoic acid?
3-dodecanoyloxyhexanoic acid has a molecular weight of 314.47 g/mol, XLogP of 5.09, 15 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dodecanoyloxyhexanoic acid is sourced from PubChem (CID 171117373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).