C28H42O4 — CID 171117402
3-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxyhexanoic acid (PubChem CID 171117402) has the molecular formula C28H42O4 and a molecular weight of 442.64 g/mol. Its IUPAC name is 3-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxyhexanoic acid.
| Compound Name | 3-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxyhexanoic acid |
|---|---|
| PubChem CID | 171117402 |
| Molecular Formula | C28H42O4 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | 3-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxyhexanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(CCC)CC(=O)O |
| InChI | InChI=1S/C28H42O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-28(31)32-26(23-4-2)25-27(29)30/h5-6,8-9,11-12,14-15,17-18,20-21,26H,3-4,7,10,13,16,19,22-25H2,1-2H3,(H,29,30)/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | PHANCPFJDAGVLQ-YNUSHXQLSA-N |
| XLogP | 7.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|