About methyl 8-[(1S,5R)-5-(2-methoxy-2-oxoethyl)-4-oxocyclopent-2-en-1-yl]octanoate
methyl 8-[(1S,5R)-5-(2-methoxy-2-oxoethyl)-4-oxocyclopent-2-en-1-yl]octanoate (PubChem CID 171117719) has the molecular formula C17H26O5
and a molecular weight of 310.39 g/mol. Its IUPAC name is methyl 8-[(1S,5R)-5-(2-methoxy-2-oxoethyl)-4-oxocyclopent-2-en-1-yl]octanoate.
Molecular Properties
| Compound Name | methyl 8-[(1S,5R)-5-(2-methoxy-2-oxoethyl)-4-oxocyclopent-2-en-1-yl]octanoate |
| PubChem CID | 171117719 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | methyl 8-[(1S,5R)-5-(2-methoxy-2-oxoethyl)-4-oxocyclopent-2-en-1-yl]octanoate |
| SMILES | COC(=O)CCCCCCC[C@H]1C=CC(=O)[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C17H26O5/c1-21-16(19)9-7-5-3-4-6-8-13-10-11-15(18)14(13)12-17(20)22-2/h10-11,13-14H,3-9,12H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | ISUPWPSZKSODJO-UONOGXRCSA-N |
| XLogP | 2.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-[(1S,5R)-5-(2-methoxy-2-oxoethyl)-4-oxocyclopent-2-en-1-yl]octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-[(1S,5R)-5-(2-methoxy-2-oxoethyl)-4-oxocyclopent-2-en-1-yl]octanoate?
The IUPAC name of methyl 8-[(1S,5R)-5-(2-methoxy-2-oxoethyl)-4-oxocyclopent-2-en-1-yl]octanoate (CID 171117719) is methyl 8-[(1S,5R)-5-(2-methoxy-2-oxoethyl)-4-oxocyclopent-2-en-1-yl]octanoate.
What is the SMILES notation for methyl 8-[(1S,5R)-5-(2-methoxy-2-oxoethyl)-4-oxocyclopent-2-en-1-yl]octanoate?
The canonical SMILES for methyl 8-[(1S,5R)-5-(2-methoxy-2-oxoethyl)-4-oxocyclopent-2-en-1-yl]octanoate is COC(=O)CCCCCCC[C@H]1C=CC(=O)[C@@H]1CC(=O)OC.
What is the InChIKey of methyl 8-[(1S,5R)-5-(2-methoxy-2-oxoethyl)-4-oxocyclopent-2-en-1-yl]octanoate?
The InChIKey is ISUPWPSZKSODJO-UONOGXRCSA-N. The full InChI is InChI=1S/C17H26O5/c1-21-16(19)9-7-5-3-4-6-8-13-10-11-15(18)14(13)12-17(20)22-2/h10-11,13-14H,3-9,12H2,1-2H3/t13-,14+/m0/s1.
What are the key properties of methyl 8-[(1S,5R)-5-(2-methoxy-2-oxoethyl)-4-oxocyclopent-2-en-1-yl]octanoate?
methyl 8-[(1S,5R)-5-(2-methoxy-2-oxoethyl)-4-oxocyclopent-2-en-1-yl]octanoate has a molecular weight of 310.39 g/mol, XLogP of 2.82, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-[(1S,5R)-5-(2-methoxy-2-oxoethyl)-4-oxocyclopent-2-en-1-yl]octanoate is sourced from PubChem (CID 171117719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).