C28H50O4 — CID 171117770
ethyl (2E,15Z)-6-ethoxy-4-oxotetracosa-2,15-dienoate (PubChem CID 171117770) has the molecular formula C28H50O4 and a molecular weight of 450.70 g/mol. Its IUPAC name is ethyl (2E,15Z)-6-ethoxy-4-oxotetracosa-2,15-dienoate.
| Compound Name | ethyl (2E,15Z)-6-ethoxy-4-oxotetracosa-2,15-dienoate |
|---|---|
| PubChem CID | 171117770 |
| Molecular Formula | C28H50O4 |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | ethyl (2E,15Z)-6-ethoxy-4-oxotetracosa-2,15-dienoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(CC(=O)/C=C/C(=O)OCC)OCC |
| InChI | InChI=1S/C28H50O4/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27(31-5-2)25-26(29)23-24-28(30)32-6-3/h13-14,23-24,27H,4-12,15-22,25H2,1-3H3/b14-13-,24-23+ |
| InChIKey | BSOZSHCIZGDCAV-AENSPDIJSA-N |
| XLogP | 7.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|