About ethyl (2E,16Z)-6-ethoxy-4-oxotetracosa-2,16-dienoate
ethyl (2E,16Z)-6-ethoxy-4-oxotetracosa-2,16-dienoate (PubChem CID 171117771) has the molecular formula C28H50O4
and a molecular weight of 450.70 g/mol. Its IUPAC name is ethyl (2E,16Z)-6-ethoxy-4-oxotetracosa-2,16-dienoate.
Molecular Properties
| Compound Name | ethyl (2E,16Z)-6-ethoxy-4-oxotetracosa-2,16-dienoate |
| PubChem CID | 171117771 |
| Molecular Formula | C28H50O4 |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | ethyl (2E,16Z)-6-ethoxy-4-oxotetracosa-2,16-dienoate |
| SMILES | CCCCCCC/C=C\CCCCCCCCCC(CC(=O)/C=C/C(=O)OCC)OCC |
| InChI | InChI=1S/C28H50O4/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27(31-5-2)25-26(29)23-24-28(30)32-6-3/h12-13,23-24,27H,4-11,14-22,25H2,1-3H3/b13-12-,24-23+ |
| InChIKey | AMRDDACTHJMFTE-YVWCZWDDSA-N |
| XLogP | 7.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2E,16Z)-6-ethoxy-4-oxotetracosa-2,16-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2E,16Z)-6-ethoxy-4-oxotetracosa-2,16-dienoate?
The IUPAC name of ethyl (2E,16Z)-6-ethoxy-4-oxotetracosa-2,16-dienoate (CID 171117771) is ethyl (2E,16Z)-6-ethoxy-4-oxotetracosa-2,16-dienoate.
What is the SMILES notation for ethyl (2E,16Z)-6-ethoxy-4-oxotetracosa-2,16-dienoate?
The canonical SMILES for ethyl (2E,16Z)-6-ethoxy-4-oxotetracosa-2,16-dienoate is CCCCCCC/C=C\CCCCCCCCCC(CC(=O)/C=C/C(=O)OCC)OCC.
What is the InChIKey of ethyl (2E,16Z)-6-ethoxy-4-oxotetracosa-2,16-dienoate?
The InChIKey is AMRDDACTHJMFTE-YVWCZWDDSA-N. The full InChI is InChI=1S/C28H50O4/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27(31-5-2)25-26(29)23-24-28(30)32-6-3/h12-13,23-24,27H,4-11,14-22,25H2,1-3H3/b13-12-,24-23+.
What are the key properties of ethyl (2E,16Z)-6-ethoxy-4-oxotetracosa-2,16-dienoate?
ethyl (2E,16Z)-6-ethoxy-4-oxotetracosa-2,16-dienoate has a molecular weight of 450.70 g/mol, XLogP of 7.90, 23 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2E,16Z)-6-ethoxy-4-oxotetracosa-2,16-dienoate is sourced from PubChem (CID 171117771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).