C22H32O7 — CID 171117857
[(1S,2S,3R,4R,7S,8Z,12S,13S,16R,17R)-2,3,16-trihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-12-yl] acetate (PubChem CID 171117857) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is [(1S,2S,3R,4R,7S,8Z,12S,13S,16R,17R)-2,3,16-trihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-12-yl] acetate.
| Compound Name | [(1S,2S,3R,4R,7S,8Z,12S,13S,16R,17R)-2,3,16-trihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-12-yl] acetate |
|---|---|
| PubChem CID | 171117857 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | [(1S,2S,3R,4R,7S,8Z,12S,13S,16R,17R)-2,3,16-trihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-12-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC/C(C)=C\[C@@H]2OC(=O)[C@H](C)[C@@]2(O)[C@@H](O)[C@H]2[C@@H](C)[C@H](O)C=C[C@@]21C |
| InChI | InChI=1S/C22H32O7/c1-11-6-7-16(28-14(4)23)21(5)9-8-15(24)12(2)18(21)19(25)22(27)13(3)20(26)29-17(22)10-11/h8-10,12-13,15-19,24-25,27H,6-7H2,1-5H3/b11-10-/t12-,13-,15+,16-,17-,18+,19-,21+,22-/m0/s1 |
| InChIKey | XJQWGBWSOQMBLH-NEQMJZCSSA-N |
| XLogP | 1.50 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|