About 4,5-ditert-butyl-2,3-dihydroxybenzaldehyde
4,5-ditert-butyl-2,3-dihydroxybenzaldehyde (PubChem CID 171118062) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is 4,5-ditert-butyl-2,3-dihydroxybenzaldehyde.
Molecular Properties
| Compound Name | 4,5-ditert-butyl-2,3-dihydroxybenzaldehyde |
| PubChem CID | 171118062 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 4,5-ditert-butyl-2,3-dihydroxybenzaldehyde |
| SMILES | CC(C)(C)c1cc(C=O)c(O)c(O)c1C(C)(C)C |
| InChI | InChI=1S/C15H22O3/c1-14(2,3)10-7-9(8-16)12(17)13(18)11(10)15(4,5)6/h7-8,17-18H,1-6H3 |
| InChIKey | BUPJYPVOAFUVPF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4,5-ditert-butyl-2,3-dihydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-ditert-butyl-2,3-dihydroxybenzaldehyde?
The IUPAC name of 4,5-ditert-butyl-2,3-dihydroxybenzaldehyde (CID 171118062) is 4,5-ditert-butyl-2,3-dihydroxybenzaldehyde.
What is the SMILES notation for 4,5-ditert-butyl-2,3-dihydroxybenzaldehyde?
The canonical SMILES for 4,5-ditert-butyl-2,3-dihydroxybenzaldehyde is CC(C)(C)c1cc(C=O)c(O)c(O)c1C(C)(C)C.
What is the InChIKey of 4,5-ditert-butyl-2,3-dihydroxybenzaldehyde?
The InChIKey is BUPJYPVOAFUVPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-14(2,3)10-7-9(8-16)12(17)13(18)11(10)15(4,5)6/h7-8,17-18H,1-6H3.
What are the key properties of 4,5-ditert-butyl-2,3-dihydroxybenzaldehyde?
4,5-ditert-butyl-2,3-dihydroxybenzaldehyde has a molecular weight of 250.34 g/mol, XLogP of 3.51, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-ditert-butyl-2,3-dihydroxybenzaldehyde is sourced from PubChem (CID 171118062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).