C26H38O5 — CID 171118666
(6S)-3,5,6-trihydroxy-4,6-dimethyl-2-[(9Z,12Z,15E)-octadeca-9,12,15-trienoyl]cyclohexa-2,4-dien-1-one (PubChem CID 171118666) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is (6S)-3,5,6-trihydroxy-4,6-dimethyl-2-[(9Z,12Z,15E)-octadeca-9,12,15-trienoyl]cyclohexa-2,4-dien-1-one.
| Compound Name | (6S)-3,5,6-trihydroxy-4,6-dimethyl-2-[(9Z,12Z,15E)-octadeca-9,12,15-trienoyl]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 171118666 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (6S)-3,5,6-trihydroxy-4,6-dimethyl-2-[(9Z,12Z,15E)-octadeca-9,12,15-trienoyl]cyclohexa-2,4-dien-1-one |
| SMILES | CC/C=C/C/C=C\C/C=C\CCCCCCCC(=O)C1=C(O)C(C)=C(O)[C@](C)(O)C1=O |
| InChI | InChI=1S/C26H38O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(27)22-23(28)20(2)24(29)26(3,31)25(22)30/h5-6,8-9,11-12,28-29,31H,4,7,10,13-19H2,1-3H3/b6-5+,9-8-,12-11-/t26-/m0/s1 |
| InChIKey | YJSUQPIYADONQI-ZJNXWBICSA-N |
| XLogP | 6.12 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|