C26H40O5 — CID 171118675
(6R)-3,5,6-trihydroxy-4,6-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienoyl]cyclohexa-2,4-dien-1-one (PubChem CID 171118675) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is (6R)-3,5,6-trihydroxy-4,6-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienoyl]cyclohexa-2,4-dien-1-one.
| Compound Name | (6R)-3,5,6-trihydroxy-4,6-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienoyl]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 171118675 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | (6R)-3,5,6-trihydroxy-4,6-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienoyl]cyclohexa-2,4-dien-1-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)C1=C(O)C(C)=C(O)[C@@](C)(O)C1=O |
| InChI | InChI=1S/C26H40O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(27)22-23(28)20(2)24(29)26(3,31)25(22)30/h8-9,11-12,28-29,31H,4-7,10,13-19H2,1-3H3/b9-8-,12-11-/t26-/m1/s1 |
| InChIKey | ZNDXWRKVZILILL-WUEUAWJUSA-N |
| XLogP | 6.35 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|