C21H21ClO5 — CID 171118863
8-chloro-3,9-dihydroxy-4,7,10-trimethyl-1-[(Z)-pent-3-en-2-yl]benzo[b][1,4]benzodioxepin-6-one (PubChem CID 171118863) has the molecular formula C21H21ClO5 and a molecular weight of 388.85 g/mol. Its IUPAC name is 8-chloro-3,9-dihydroxy-4,7,10-trimethyl-1-[(Z)-pent-3-en-2-yl]benzo[b][1,4]benzodioxepin-6-one.
| Compound Name | 8-chloro-3,9-dihydroxy-4,7,10-trimethyl-1-[(Z)-pent-3-en-2-yl]benzo[b][1,4]benzodioxepin-6-one |
|---|---|
| PubChem CID | 171118863 |
| Molecular Formula | C21H21ClO5 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 8-chloro-3,9-dihydroxy-4,7,10-trimethyl-1-[(Z)-pent-3-en-2-yl]benzo[b][1,4]benzodioxepin-6-one |
| SMILES | C/C=C\C(C)c1cc(O)c(C)c2c1Oc1c(C)c(O)c(Cl)c(C)c1C(=O)O2 |
| InChI | InChI=1S/C21H21ClO5/c1-6-7-9(2)13-8-14(23)10(3)19-20(13)26-18-12(5)17(24)16(22)11(4)15(18)21(25)27-19/h6-9,23-24H,1-5H3/b7-6- |
| InChIKey | YHFVEOLVMJRQPS-SREVYHEPSA-N |
| XLogP | 5.68 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|