C14H23NO — CID 171119155
(2E,4E)-N-(2-methylpropyl)deca-2,4,9-trienamide (PubChem CID 171119155) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (2E,4E)-N-(2-methylpropyl)deca-2,4,9-trienamide.
| Compound Name | (2E,4E)-N-(2-methylpropyl)deca-2,4,9-trienamide |
|---|---|
| PubChem CID | 171119155 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (2E,4E)-N-(2-methylpropyl)deca-2,4,9-trienamide |
| SMILES | C=CCCC/C=C/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C14H23NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h4,8-11,13H,1,5-7,12H2,2-3H3,(H,15,16)/b9-8+,11-10+ |
| InChIKey | OBMHOOZXZMQKRR-BNFZFUHLSA-N |
| XLogP | 3.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|