C24H32O4 — CID 171119420
5-[(3R,5R,8R,9S,10S,13R,16R,17S)-3,16-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one (PubChem CID 171119420) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is 5-[(3R,5R,8R,9S,10S,13R,16R,17S)-3,16-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one.
| Compound Name | 5-[(3R,5R,8R,9S,10S,13R,16R,17S)-3,16-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
|---|---|
| PubChem CID | 171119420 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 5-[(3R,5R,8R,9S,10S,13R,16R,17S)-3,16-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
| SMILES | C[C@]12CC[C@@H](O)C[C@H]1CC[C@H]1C3=C[C@@H](O)[C@H](c4ccc(=O)oc4)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C24H32O4/c1-23-9-7-16(25)11-15(23)4-5-17-18(23)8-10-24(2)19(17)12-20(26)22(24)14-3-6-21(27)28-13-14/h3,6,12-13,15-18,20,22,25-26H,4-5,7-11H2,1-2H3/t15-,16-,17-,18+,20-,22+,23+,24+/m1/s1 |
| InChIKey | FAFGVVFWBPTHIW-RZAYARLVSA-N |
| XLogP | 4.02 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|