C19H30O7 — CID 171119452
methyl (2E,6E,10R)-11-hydroxy-10-[2-hydroxy-3-(hydroxymethyl)but-3-enoyl]oxy-11-methyldodeca-2,6-dienoate (PubChem CID 171119452) has the molecular formula C19H30O7 and a molecular weight of 370.44 g/mol. Its IUPAC name is methyl (2E,6E,10R)-11-hydroxy-10-[2-hydroxy-3-(hydroxymethyl)but-3-enoyl]oxy-11-methyldodeca-2,6-dienoate.
| Compound Name | methyl (2E,6E,10R)-11-hydroxy-10-[2-hydroxy-3-(hydroxymethyl)but-3-enoyl]oxy-11-methyldodeca-2,6-dienoate |
|---|---|
| PubChem CID | 171119452 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | methyl (2E,6E,10R)-11-hydroxy-10-[2-hydroxy-3-(hydroxymethyl)but-3-enoyl]oxy-11-methyldodeca-2,6-dienoate |
| SMILES | C=C(CO)C(O)C(=O)O[C@H](CC/C=C/CC/C=C/C(=O)OC)C(C)(C)O |
| InChI | InChI=1S/C19H30O7/c1-14(13-20)17(22)18(23)26-15(19(2,3)24)11-9-7-5-6-8-10-12-16(21)25-4/h5,7,10,12,15,17,20,22,24H,1,6,8-9,11,13H2,2-4H3/b7-5+,12-10+/t15-,17?/m1/s1 |
| InChIKey | KXCFGOVISYQITL-GQWHPFFXSA-N |
| XLogP | 1.42 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|