C20H30O — CID 171119629
(1R,7E,10R,16S)-1,8,12,12-tetramethyl-4-methylidene-11-oxatricyclo[8.5.1.013,16]hexadeca-7,13-diene (PubChem CID 171119629) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (1R,7E,10R,16S)-1,8,12,12-tetramethyl-4-methylidene-11-oxatricyclo[8.5.1.013,16]hexadeca-7,13-diene.
| Compound Name | (1R,7E,10R,16S)-1,8,12,12-tetramethyl-4-methylidene-11-oxatricyclo[8.5.1.013,16]hexadeca-7,13-diene |
|---|---|
| PubChem CID | 171119629 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (1R,7E,10R,16S)-1,8,12,12-tetramethyl-4-methylidene-11-oxatricyclo[8.5.1.013,16]hexadeca-7,13-diene |
| SMILES | C=C1CC/C=C(\C)C[C@H]2OC(C)(C)C3=CC[C@@](C)(CC1)[C@@H]32 |
| InChI | InChI=1S/C20H30O/c1-14-7-6-8-15(2)13-17-18-16(19(3,4)21-17)10-12-20(18,5)11-9-14/h8,10,17-18H,1,6-7,9,11-13H2,2-5H3/b15-8+/t17-,18+,20-/m1/s1 |
| InChIKey | GWFUANKORWPORG-PLLMSKFTSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|