C35H43N5O3 — CID 171119731
3-[(18R)-18-[(4S)-4-amino-5-methyl-3-oxohexyl]-3,8,13,17,17-pentamethyl-21,23-dihydro-18H-porphyrin-2-yl]propanoic acid (PubChem CID 171119731) has the molecular formula C35H43N5O3 and a molecular weight of 581.76 g/mol. Its IUPAC name is 3-[(18R)-18-[(4S)-4-amino-5-methyl-3-oxohexyl]-3,8,13,17,17-pentamethyl-21,23-dihydro-18H-porphyrin-2-yl]propanoic acid.
| Compound Name | 3-[(18R)-18-[(4S)-4-amino-5-methyl-3-oxohexyl]-3,8,13,17,17-pentamethyl-21,23-dihydro-18H-porphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 171119731 |
| Molecular Formula | C35H43N5O3 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.34 |
| IUPAC Name | 3-[(18R)-18-[(4S)-4-amino-5-methyl-3-oxohexyl]-3,8,13,17,17-pentamethyl-21,23-dihydro-18H-porphyrin-2-yl]propanoic acid |
| SMILES | CC1=Cc2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)cc5C)C(C)(C)[C@H]4CCC(=O)[C@@H](N)C(C)C)c(CCC(=O)O)c3C |
| InChI | InChI=1S/C35H43N5O3/c1-18(2)34(36)31(41)10-9-25-30-16-29-24(8-11-33(42)43)21(5)28(39-29)15-23-12-19(3)26(37-23)14-22-13-20(4)27(38-22)17-32(40-30)35(25,6)7/h12-18,25,34,38-39H,8-11,36H2,1-7H3,(H,42,43)/b22-14-,23-15-,26-14-,27-17-,28-15-,29-16-,30-16-,32-17-/t25-,34-/m0/s1 |
| InChIKey | FVTSLVNHWKACQN-YSBKYRBQSA-N |
| XLogP | 6.90 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |