C22H32O4 — CID 171119893
[1-methoxy-4-oxo-3-[(3Z,6Z,9Z)-tetradeca-3,6,9-trienyl]cyclopent-2-en-1-yl] acetate (PubChem CID 171119893) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [1-methoxy-4-oxo-3-[(3Z,6Z,9Z)-tetradeca-3,6,9-trienyl]cyclopent-2-en-1-yl] acetate.
| Compound Name | [1-methoxy-4-oxo-3-[(3Z,6Z,9Z)-tetradeca-3,6,9-trienyl]cyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 171119893 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [1-methoxy-4-oxo-3-[(3Z,6Z,9Z)-tetradeca-3,6,9-trienyl]cyclopent-2-en-1-yl] acetate |
| SMILES | CCCC/C=C\C/C=C\C/C=C\CCC1=CC(OC)(OC(C)=O)CC1=O |
| InChI | InChI=1S/C22H32O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-20-17-22(25-3,18-21(20)24)26-19(2)23/h7-8,10-11,13-14,17H,4-6,9,12,15-16,18H2,1-3H3/b8-7-,11-10-,14-13- |
| InChIKey | RKFHNCDDZZBUNK-JPFHKJGASA-N |
| XLogP | 5.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|