C20H30O2 — CID 171120074
(3aE,6E,10aR)-7-methyl-10-[(2S)-6-methylhept-5-en-2-yl]-1,5,8,9,10,10a-hexahydrocyclonona[c]furan-3-one (PubChem CID 171120074) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (3aE,6E,10aR)-7-methyl-10-[(2S)-6-methylhept-5-en-2-yl]-1,5,8,9,10,10a-hexahydrocyclonona[c]furan-3-one.
| Compound Name | (3aE,6E,10aR)-7-methyl-10-[(2S)-6-methylhept-5-en-2-yl]-1,5,8,9,10,10a-hexahydrocyclonona[c]furan-3-one |
|---|---|
| PubChem CID | 171120074 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (3aE,6E,10aR)-7-methyl-10-[(2S)-6-methylhept-5-en-2-yl]-1,5,8,9,10,10a-hexahydrocyclonona[c]furan-3-one |
| SMILES | CC(C)=CCC[C@H](C)C1CC/C(C)=C/C/C=C2/C(=O)OC[C@@H]21 |
| InChI | InChI=1S/C20H30O2/c1-14(2)7-5-9-16(4)17-12-11-15(3)8-6-10-18-19(17)13-22-20(18)21/h7-8,10,16-17,19H,5-6,9,11-13H2,1-4H3/b15-8+,18-10+/t16-,17?,19+/m0/s1 |
| InChIKey | NXLGBKUVXJCGJY-PZNRFKELSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|