C30H40O2 — CID 171120360
(2E,4E,6E,8E,10E,12E,14E,16E,18E,22E)-24-hydroxy-2,6,10,15,19,23-hexamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaenal (PubChem CID 171120360) has the molecular formula C30H40O2 and a molecular weight of 432.65 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E,14E,16E,18E,22E)-24-hydroxy-2,6,10,15,19,23-hexamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaenal.
| Compound Name | (2E,4E,6E,8E,10E,12E,14E,16E,18E,22E)-24-hydroxy-2,6,10,15,19,23-hexamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaenal |
|---|---|
| PubChem CID | 171120360 |
| Molecular Formula | C30H40O2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E,14E,16E,18E,22E)-24-hydroxy-2,6,10,15,19,23-hexamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaenal |
| SMILES | C/C(C=O)=C\C=C\C(C)=C\C=C\C(C)=C\C=C\C=C(C)\C=C\C=C(/C)CC/C=C(\C)CO |
| InChI | InChI=1S/C30H40O2/c1-25(15-9-17-27(3)19-11-21-29(5)23-31)13-7-8-14-26(2)16-10-18-28(4)20-12-22-30(6)24-32/h7-11,13-19,21-23,32H,12,20,24H2,1-6H3/b8-7+,15-9+,16-10+,19-11+,25-13+,26-14+,27-17+,28-18+,29-21+,30-22+ |
| InChIKey | JNAQTYYJMBJZIS-RQVZEEHKSA-N |
| XLogP | 7.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|