C23H42N3+ — CID 171120547
(1R,4S,6R,10R)-6-[(Z)-hept-4-enyl]-10-heptyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene (PubChem CID 171120547) has the molecular formula C23H42N3+ and a molecular weight of 360.61 g/mol. Its IUPAC name is (1R,4S,6R,10R)-6-[(Z)-hept-4-enyl]-10-heptyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene.
| Compound Name | (1R,4S,6R,10R)-6-[(Z)-hept-4-enyl]-10-heptyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene |
|---|---|
| PubChem CID | 171120547 |
| Molecular Formula | C23H42N3+ |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.34 |
| IUPAC Name | (1R,4S,6R,10R)-6-[(Z)-hept-4-enyl]-10-heptyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene |
| SMILES | CC/C=C\CCC[C@@H]1C[C@@H]2CC[C@@H]3C[C@@H](CCCCCCC)NC(=[N+]32)N1 |
| InChI | InChI=1S/C23H41N3/c1-3-5-7-9-11-13-19-17-21-15-16-22-18-20(14-12-10-8-6-4-2)25-23(24-19)26(21)22/h5,7,19-22H,3-4,6,8-18H2,1-2H3,(H,24,25)/p+1/b7-5-/t19-,20-,21+,22-/m1/s1 |
| InChIKey | RTIHUTXMEHQCPS-CQKXHVGVSA-O |
| XLogP | 5.11 |
| TPSA | 27.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|