C20H36N2O3 — CID 171120690
(2S)-6-amino-2-[[(5Z,8Z)-tetradeca-5,8-dienoyl]amino]hexanoic acid (PubChem CID 171120690) has the molecular formula C20H36N2O3 and a molecular weight of 352.52 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(5Z,8Z)-tetradeca-5,8-dienoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(5Z,8Z)-tetradeca-5,8-dienoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 171120690 |
| Molecular Formula | C20H36N2O3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | (2S)-6-amino-2-[[(5Z,8Z)-tetradeca-5,8-dienoyl]amino]hexanoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCC(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C20H36N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-16-19(23)22-18(20(24)25)15-13-14-17-21/h6-7,9-10,18H,2-5,8,11-17,21H2,1H3,(H,22,23)(H,24,25)/b7-6-,10-9-/t18-/m0/s1 |
| InChIKey | KWVQXGZFFMOVRU-RKRHOQAZSA-N |
| XLogP | 3.94 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|