C42H62O3 — CID 171120912
(2E,4E,6E,8E,10E,12E,14E)-19-methoxy-2-[(1E,3E,5E,7E)-12-methoxy-4,8,12-trimethyltrideca-1,3,5,7-tetraenyl]-7,11,15,19-tetramethylicosa-2,4,6,8,10,12,14-heptaenal (PubChem CID 171120912) has the molecular formula C42H62O3 and a molecular weight of 614.96 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E,14E)-19-methoxy-2-[(1E,3E,5E,7E)-12-methoxy-4,8,12-trimethyltrideca-1,3,5,7-tetraenyl]-7,11,15,19-tetramethylicosa-2,4,6,8,10,12,14-heptaenal.
| Compound Name | (2E,4E,6E,8E,10E,12E,14E)-19-methoxy-2-[(1E,3E,5E,7E)-12-methoxy-4,8,12-trimethyltrideca-1,3,5,7-tetraenyl]-7,11,15,19-tetramethylicosa-2,4,6,8,10,12,14-heptaenal |
|---|---|
| PubChem CID | 171120912 |
| Molecular Formula | C42H62O3 |
| Molecular Weight | 614.96 g/mol |
| Exact Mass | 614.47 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E,14E)-19-methoxy-2-[(1E,3E,5E,7E)-12-methoxy-4,8,12-trimethyltrideca-1,3,5,7-tetraenyl]-7,11,15,19-tetramethylicosa-2,4,6,8,10,12,14-heptaenal |
| SMILES | COC(C)(C)CCC/C(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C=O)\C=C\C=C(C)\C=C\C=C(/C)CCCC(C)(C)OC |
| InChI | InChI=1S/C42H62O3/c1-35(21-14-22-36(2)23-15-25-38(4)28-18-32-41(6,7)44-10)20-12-13-30-40(34-43)31-17-27-37(3)24-16-26-39(5)29-19-33-42(8,9)45-11/h12-17,20-27,30-31,34H,18-19,28-29,32-33H2,1-11H3/b13-12+,21-14+,23-15+,24-16+,31-17+,35-20+,36-22+,37-27+,38-25+,39-26+,40-30+ |
| InChIKey | PNTYNLHQUBJAGK-NWXDQPGOSA-N |
| XLogP | 11.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.96 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|