About [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] dodecanoate
[(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] dodecanoate (PubChem CID 171121102) has the molecular formula C19H36O5
and a molecular weight of 344.49 g/mol. Its IUPAC name is [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] dodecanoate.
Molecular Properties
| Compound Name | [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] dodecanoate |
| PubChem CID | 171121102 |
| Molecular Formula | C19H36O5 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] dodecanoate |
| SMILES | CCCCCCCCCCCC(=O)O[C@H](C(C)C)[C@@H](O)C(=O)OC |
| InChI | InChI=1S/C19H36O5/c1-5-6-7-8-9-10-11-12-13-14-16(20)24-18(15(2)3)17(21)19(22)23-4/h15,17-18,21H,5-14H2,1-4H3/t17-,18-/m1/s1 |
| InChIKey | CKRCOYVDGHCAQO-QZTJIDSGSA-N |
| XLogP | 4.01 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] dodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] dodecanoate?
The IUPAC name of [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] dodecanoate (CID 171121102) is [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] dodecanoate.
What is the SMILES notation for [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] dodecanoate?
The canonical SMILES for [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] dodecanoate is CCCCCCCCCCCC(=O)O[C@H](C(C)C)[C@@H](O)C(=O)OC.
What is the InChIKey of [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] dodecanoate?
The InChIKey is CKRCOYVDGHCAQO-QZTJIDSGSA-N. The full InChI is InChI=1S/C19H36O5/c1-5-6-7-8-9-10-11-12-13-14-16(20)24-18(15(2)3)17(21)19(22)23-4/h15,17-18,21H,5-14H2,1-4H3/t17-,18-/m1/s1.
What are the key properties of [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] dodecanoate?
[(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] dodecanoate has a molecular weight of 344.49 g/mol, XLogP of 4.01, 14 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] dodecanoate is sourced from PubChem (CID 171121102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).