About [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] tridecanoate
[(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] tridecanoate (PubChem CID 171121104) has the molecular formula C20H38O5
and a molecular weight of 358.52 g/mol. Its IUPAC name is [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] tridecanoate.
Molecular Properties
| Compound Name | [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] tridecanoate |
| PubChem CID | 171121104 |
| Molecular Formula | C20H38O5 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] tridecanoate |
| SMILES | CCCCCCCCCCCCC(=O)O[C@H](C(C)C)[C@@H](O)C(=O)OC |
| InChI | InChI=1S/C20H38O5/c1-5-6-7-8-9-10-11-12-13-14-15-17(21)25-19(16(2)3)18(22)20(23)24-4/h16,18-19,22H,5-15H2,1-4H3/t18-,19-/m1/s1 |
| InChIKey | GGDBPLUALAQSBY-RTBURBONSA-N |
| XLogP | 4.40 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] tridecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] tridecanoate?
The IUPAC name of [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] tridecanoate (CID 171121104) is [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] tridecanoate.
What is the SMILES notation for [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] tridecanoate?
The canonical SMILES for [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] tridecanoate is CCCCCCCCCCCCC(=O)O[C@H](C(C)C)[C@@H](O)C(=O)OC.
What is the InChIKey of [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] tridecanoate?
The InChIKey is GGDBPLUALAQSBY-RTBURBONSA-N. The full InChI is InChI=1S/C20H38O5/c1-5-6-7-8-9-10-11-12-13-14-15-17(21)25-19(16(2)3)18(22)20(23)24-4/h16,18-19,22H,5-15H2,1-4H3/t18-,19-/m1/s1.
What are the key properties of [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] tridecanoate?
[(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] tridecanoate has a molecular weight of 358.52 g/mol, XLogP of 4.40, 15 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] tridecanoate is sourced from PubChem (CID 171121104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).