About [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] undecanoate
[(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] undecanoate (PubChem CID 171121106) has the molecular formula C18H34O5
and a molecular weight of 330.47 g/mol. Its IUPAC name is [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] undecanoate.
Molecular Properties
| Compound Name | [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] undecanoate |
| PubChem CID | 171121106 |
| Molecular Formula | C18H34O5 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] undecanoate |
| SMILES | CCCCCCCCCCC(=O)O[C@H](C(C)C)[C@@H](O)C(=O)OC |
| InChI | InChI=1S/C18H34O5/c1-5-6-7-8-9-10-11-12-13-15(19)23-17(14(2)3)16(20)18(21)22-4/h14,16-17,20H,5-13H2,1-4H3/t16-,17-/m1/s1 |
| InChIKey | FNQUAQOLDOZTBE-IAGOWNOFSA-N |
| XLogP | 3.62 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] undecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] undecanoate?
The IUPAC name of [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] undecanoate (CID 171121106) is [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] undecanoate.
What is the SMILES notation for [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] undecanoate?
The canonical SMILES for [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] undecanoate is CCCCCCCCCCC(=O)O[C@H](C(C)C)[C@@H](O)C(=O)OC.
What is the InChIKey of [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] undecanoate?
The InChIKey is FNQUAQOLDOZTBE-IAGOWNOFSA-N. The full InChI is InChI=1S/C18H34O5/c1-5-6-7-8-9-10-11-12-13-15(19)23-17(14(2)3)16(20)18(21)22-4/h14,16-17,20H,5-13H2,1-4H3/t16-,17-/m1/s1.
What are the key properties of [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] undecanoate?
[(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] undecanoate has a molecular weight of 330.47 g/mol, XLogP of 3.62, 13 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-2-hydroxy-1-methoxy-4-methyl-1-oxopentan-3-yl] undecanoate is sourced from PubChem (CID 171121106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).