C20H32O2 — CID 171121377
(1S,2E,4Z,7E,11E)-1-(2-hydroxypropan-2-yl)-4,8,12-trimethylcyclotetradeca-2,4,7,11-tetraen-1-ol (PubChem CID 171121377) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,2E,4Z,7E,11E)-1-(2-hydroxypropan-2-yl)-4,8,12-trimethylcyclotetradeca-2,4,7,11-tetraen-1-ol.
| Compound Name | (1S,2E,4Z,7E,11E)-1-(2-hydroxypropan-2-yl)-4,8,12-trimethylcyclotetradeca-2,4,7,11-tetraen-1-ol |
|---|---|
| PubChem CID | 171121377 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,2E,4Z,7E,11E)-1-(2-hydroxypropan-2-yl)-4,8,12-trimethylcyclotetradeca-2,4,7,11-tetraen-1-ol |
| SMILES | CC1=C/C/C=C(\C)CC/C=C(/C)CC[C@@](O)(C(C)(C)O)\C=C\1 |
| InChI | InChI=1S/C20H32O2/c1-16-8-6-10-17(2)12-14-20(22,19(4,5)21)15-13-18(3)11-7-9-16/h8,10-12,14,21-22H,6-7,9,13,15H2,1-5H3/b14-12+,16-8+,17-10-,18-11-/t20-/m1/s1 |
| InChIKey | SECPNCQNMJDPBF-WXMVTTJUSA-N |
| XLogP | 4.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|