About 2-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethoxy)aniline
2-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethoxy)aniline (PubChem CID 171121686) has the molecular formula C11H11F5N2O
and a molecular weight of 282.21 g/mol. Its IUPAC name is 2-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethoxy)aniline.
Molecular Properties
| Compound Name | 2-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethoxy)aniline |
| PubChem CID | 171121686 |
| Molecular Formula | C11H11F5N2O |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethoxy)aniline |
| SMILES | Nc1cc(OC(F)(F)F)ccc1N1CCC(F)(F)C1 |
| InChI | InChI=1S/C11H11F5N2O/c12-10(13)3-4-18(6-10)9-2-1-7(5-8(9)17)19-11(14,15)16/h1-2,5H,3-4,6,17H2 |
| InChIKey | QPSYIXKVNAKLDR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethoxy)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethoxy)aniline?
The IUPAC name of 2-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethoxy)aniline (CID 171121686) is 2-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethoxy)aniline.
What is the SMILES notation for 2-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethoxy)aniline?
The canonical SMILES for 2-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethoxy)aniline is Nc1cc(OC(F)(F)F)ccc1N1CCC(F)(F)C1.
What is the InChIKey of 2-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethoxy)aniline?
The InChIKey is QPSYIXKVNAKLDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F5N2O/c12-10(13)3-4-18(6-10)9-2-1-7(5-8(9)17)19-11(14,15)16/h1-2,5H,3-4,6,17H2.
What are the key properties of 2-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethoxy)aniline?
2-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethoxy)aniline has a molecular weight of 282.21 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethoxy)aniline is sourced from PubChem (CID 171121686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).