C18H24O10S — CID 171121852
[(2R,3R,4R)-4-acetyloxy-5-hydroxy-2-[(4-methylphenoxy)methyl]-5-(methylsulfonyloxymethyl)oxolan-3-yl] acetate (PubChem CID 171121852) has the molecular formula C18H24O10S and a molecular weight of 432.45 g/mol. Its IUPAC name is [(2R,3R,4R)-4-acetyloxy-5-hydroxy-2-[(4-methylphenoxy)methyl]-5-(methylsulfonyloxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R)-4-acetyloxy-5-hydroxy-2-[(4-methylphenoxy)methyl]-5-(methylsulfonyloxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 171121852 |
| Molecular Formula | C18H24O10S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | [(2R,3R,4R)-4-acetyloxy-5-hydroxy-2-[(4-methylphenoxy)methyl]-5-(methylsulfonyloxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)C(O)(COS(C)(=O)=O)O[C@@H]1COc1ccc(C)cc1 |
| InChI | InChI=1S/C18H24O10S/c1-11-5-7-14(8-6-11)24-9-15-16(26-12(2)19)17(27-13(3)20)18(21,28-15)10-25-29(4,22)23/h5-8,15-17,21H,9-10H2,1-4H3/t15-,16-,17-,18?/m1/s1 |
| InChIKey | KFFXTTONMZVHLV-NGHJQRJNSA-N |
| XLogP | 0.30 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|