C38H43NO6S — CID 171123164
(2S,3S,4R,5R,6R)-3-(cyclohexylamino)-4-(4-methylphenyl)sulfonyl-6-(trityloxymethyl)oxane-2,5-diol (PubChem CID 171123164) has the molecular formula C38H43NO6S and a molecular weight of 641.83 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-3-(cyclohexylamino)-4-(4-methylphenyl)sulfonyl-6-(trityloxymethyl)oxane-2,5-diol.
| Compound Name | (2S,3S,4R,5R,6R)-3-(cyclohexylamino)-4-(4-methylphenyl)sulfonyl-6-(trityloxymethyl)oxane-2,5-diol |
|---|---|
| PubChem CID | 171123164 |
| Molecular Formula | C38H43NO6S |
| Molecular Weight | 641.83 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | (2S,3S,4R,5R,6R)-3-(cyclohexylamino)-4-(4-methylphenyl)sulfonyl-6-(trityloxymethyl)oxane-2,5-diol |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2[C@H](O)[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)O[C@H](O)[C@@H]2NC2CCCCC2)cc1 |
| InChI | InChI=1S/C38H43NO6S/c1-27-22-24-32(25-23-27)46(42,43)36-34(39-31-20-12-5-13-21-31)37(41)45-33(35(36)40)26-44-38(28-14-6-2-7-15-28,29-16-8-3-9-17-29)30-18-10-4-11-19-30/h2-4,6-11,14-19,22-25,31,33-37,39-41H,5,12-13,20-21,26H2,1H3/t33-,34-,35-,36-,37+/m1/s1 |
| InChIKey | QYOLOFJRFOLNDI-QRZOQVTHSA-N |
| XLogP | 5.52 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.83 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|