C31H28O14 — CID 171124187
(2R,3S)-2-(3,5-dihydroxy-4-methoxyphenyl)-8-[(2R,3R,4S)-3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol (PubChem CID 171124187) has the molecular formula C31H28O14 and a molecular weight of 624.55 g/mol. Its IUPAC name is (2R,3S)-2-(3,5-dihydroxy-4-methoxyphenyl)-8-[(2R,3R,4S)-3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol.
| Compound Name | (2R,3S)-2-(3,5-dihydroxy-4-methoxyphenyl)-8-[(2R,3R,4S)-3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 171124187 |
| Molecular Formula | C31H28O14 |
| Molecular Weight | 624.55 g/mol |
| Exact Mass | 624.15 |
| IUPAC Name | (2R,3S)-2-(3,5-dihydroxy-4-methoxyphenyl)-8-[(2R,3R,4S)-3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES | COc1c(O)cc([C@H]2Oc3c(c(O)cc(O)c3[C@@H]3c4c(O)cc(O)cc4O[C@H](c4cc(O)c(O)c(O)c4)[C@@H]3O)C[C@@H]2O)cc1O |
| InChI | InChI=1S/C31H28O14/c1-43-31-19(38)4-10(5-20(31)39)28-21(40)8-13-14(33)9-16(35)24(30(13)45-28)25-23-15(34)6-12(32)7-22(23)44-29(27(25)42)11-2-17(36)26(41)18(37)3-11/h2-7,9,21,25,27-29,32-42H,8H2,1H3/t21-,25-,27+,28+,29+/m0/s1 |
| InChIKey | OBBZIYVNMBINSR-CZCPHJQJSA-N |
| XLogP | 2.71 |
| TPSA | 250.22 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|